About 7-ethenyl-1,4-dioxaspiro[4.5]decane
7-ethenyl-1,4-dioxaspiro[4.5]decane (PubChem CID 69192706) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 7-ethenyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-ethenyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 69192706 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 7-ethenyl-1,4-dioxaspiro[4.5]decane |
| SMILES | C=CC1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C10H16O2/c1-2-9-4-3-5-10(8-9)11-6-7-12-10/h2,9H,1,3-8H2 |
| InChIKey | HINHVHVNKGETMK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-ethenyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 7-ethenyl-1,4-dioxaspiro[4.5]decane (CID 69192706) is 7-ethenyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 7-ethenyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 7-ethenyl-1,4-dioxaspiro[4.5]decane is C=CC1CCCC2(C1)OCCO2.
What is the InChIKey of 7-ethenyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is HINHVHVNKGETMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-2-9-4-3-5-10(8-9)11-6-7-12-10/h2,9H,1,3-8H2.
What are the key properties of 7-ethenyl-1,4-dioxaspiro[4.5]decane?
7-ethenyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 168.24 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 69192706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).