C15H11Cl2N5O3S — CID 69192777
[6-(2,6-dichlorophenyl)-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 69192777) has the molecular formula C15H11Cl2N5O3S and a molecular weight of 412.26 g/mol. Its IUPAC name is [6-(2,6-dichlorophenyl)-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | [6-(2,6-dichlorophenyl)-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 69192777 |
| Molecular Formula | C15H11Cl2N5O3S |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | [6-(2,6-dichlorophenyl)-2-methylsulfonylpyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CS(=O)(=O)c1ncc2cc(-c3c(Cl)cccc3Cl)c(NC(N)=O)nc2n1 |
| InChI | InChI=1S/C15H11Cl2N5O3S/c1-26(24,25)15-19-6-7-5-8(11-9(16)3-2-4-10(11)17)13(21-14(18)23)20-12(7)22-15/h2-6H,1H3,(H3,18,19,20,21,22,23) |
| InChIKey | ATGRYPDAMRSHBY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |