C19H21N3O3 — CID 69193320
3-(2,6,7-trimethyl-4-phenoxyimidazo[4,5-c]pyridin-1-yl)butanoic acid (PubChem CID 69193320) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-(2,6,7-trimethyl-4-phenoxyimidazo[4,5-c]pyridin-1-yl)butanoic acid.
| Compound Name | 3-(2,6,7-trimethyl-4-phenoxyimidazo[4,5-c]pyridin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 69193320 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-(2,6,7-trimethyl-4-phenoxyimidazo[4,5-c]pyridin-1-yl)butanoic acid |
| SMILES | Cc1nc(Oc2ccccc2)c2nc(C)n(C(C)CC(=O)O)c2c1C |
| InChI | InChI=1S/C19H21N3O3/c1-11(10-16(23)24)22-14(4)21-17-18(22)12(2)13(3)20-19(17)25-15-8-6-5-7-9-15/h5-9,11H,10H2,1-4H3,(H,23,24) |
| InChIKey | REJPXYZKJMIRKB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |