C15H26N5O4S+ — CID 69193428
2-[2-(4-amino-2,6,7-trimethylimidazo[4,5-c]pyridin-1-yl)ethoxy]ethyl-dimethyl-sulfoazanium (PubChem CID 69193428) has the molecular formula C15H26N5O4S+ and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[2-(4-amino-2,6,7-trimethylimidazo[4,5-c]pyridin-1-yl)ethoxy]ethyl-dimethyl-sulfoazanium.
| Compound Name | 2-[2-(4-amino-2,6,7-trimethylimidazo[4,5-c]pyridin-1-yl)ethoxy]ethyl-dimethyl-sulfoazanium |
|---|---|
| PubChem CID | 69193428 |
| Molecular Formula | C15H26N5O4S+ |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[2-(4-amino-2,6,7-trimethylimidazo[4,5-c]pyridin-1-yl)ethoxy]ethyl-dimethyl-sulfoazanium |
| SMILES | Cc1nc(N)c2nc(C)n(CCOCC[N+](C)(C)S(=O)(=O)O)c2c1C |
| InChI | InChI=1S/C15H25N5O4S/c1-10-11(2)17-15(16)13-14(10)19(12(3)18-13)6-8-24-9-7-20(4,5)25(21,22)23/h6-9H2,1-5H3,(H2-,16,17,21,22,23)/p+1 |
| InChIKey | JVFXKKBAUFSXED-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|