C24H38N6O2 — CID 69193430
1-[2-[2-[4-amino-2-(2-cyclopropylethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]ethoxy]ethyl]-1-cyclohexylurea (PubChem CID 69193430) has the molecular formula C24H38N6O2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-[2-[2-[4-amino-2-(2-cyclopropylethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]ethoxy]ethyl]-1-cyclohexylurea.
| Compound Name | 1-[2-[2-[4-amino-2-(2-cyclopropylethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]ethoxy]ethyl]-1-cyclohexylurea |
|---|---|
| PubChem CID | 69193430 |
| Molecular Formula | C24H38N6O2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 1-[2-[2-[4-amino-2-(2-cyclopropylethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]ethoxy]ethyl]-1-cyclohexylurea |
| SMILES | Cc1nc(N)c2nc(CCC3CC3)n(CCOCCN(C(N)=O)C3CCCCC3)c2c1C |
| InChI | InChI=1S/C24H38N6O2/c1-16-17(2)27-23(25)21-22(16)30(20(28-21)11-10-18-8-9-18)13-15-32-14-12-29(24(26)31)19-6-4-3-5-7-19/h18-19H,3-15H2,1-2H3,(H2,25,27)(H2,26,31) |
| InChIKey | OPJJUNWWTDCTTM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|