About (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid
(3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid (PubChem CID 69193681) has the molecular formula C14H23N3O4
and a molecular weight of 297.36 g/mol. Its IUPAC name is (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid |
| PubChem CID | 69193681 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC[C@H](NC(=O)N2[C@@H]3CC[C@H]2CC(O)C3)C1 |
| InChI | InChI=1S/C14H23N3O4/c18-12-6-10-3-4-11(7-12)17(10)13(19)15-9-2-1-5-16(8-9)14(20)21/h9-12,18H,1-8H2,(H,15,19)(H,20,21)/t9-,10-,11+,12?/m0/s1 |
| InChIKey | DIUZGRBWLCIPRA-WSMDXJOWSA-N |
| XLogP | 0.83 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid?
The IUPAC name of (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid (CID 69193681) is (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid.
What is the SMILES notation for (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid?
The canonical SMILES for (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid is O=C(O)N1CCC[C@H](NC(=O)N2[C@@H]3CC[C@H]2CC(O)C3)C1.
What is the InChIKey of (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid?
The InChIKey is DIUZGRBWLCIPRA-WSMDXJOWSA-N. The full InChI is InChI=1S/C14H23N3O4/c18-12-6-10-3-4-11(7-12)17(10)13(19)15-9-2-1-5-16(8-9)14(20)21/h9-12,18H,1-8H2,(H,15,19)(H,20,21)/t9-,10-,11+,12?/m0/s1.
What are the key properties of (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid?
(3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid has a molecular weight of 297.36 g/mol, XLogP of 0.83, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[[(1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl]amino]piperidine-1-carboxylic acid is sourced from PubChem (CID 69193681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).