C15H20F2O5 — CID 69194031
3-[2,2-bis(prop-2-enyl)-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxyhex-5-enoic acid (PubChem CID 69194031) has the molecular formula C15H20F2O5 and a molecular weight of 318.32 g/mol. Its IUPAC name is 3-[2,2-bis(prop-2-enyl)-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxyhex-5-enoic acid.
| Compound Name | 3-[2,2-bis(prop-2-enyl)-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxyhex-5-enoic acid |
|---|---|
| PubChem CID | 69194031 |
| Molecular Formula | C15H20F2O5 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 3-[2,2-bis(prop-2-enyl)-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxyhex-5-enoic acid |
| SMILES | C=CCC1(CC=C)OCC(C(O)(CC=C)C(F)(F)C(=O)O)O1 |
| InChI | InChI=1S/C15H20F2O5/c1-4-7-13(8-5-2)21-10-11(22-13)14(20,9-6-3)15(16,17)12(18)19/h4-6,11,20H,1-3,7-10H2,(H,18,19) |
| InChIKey | XONTUOJZVCTSPA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|