About 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol
4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol (PubChem CID 69194228) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol.
Molecular Properties
| Compound Name | 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol |
| PubChem CID | 69194228 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol |
| SMILES | C=CCN(CC=C)C1(O)C=CC(O)=CC1 |
| InChI | InChI=1S/C12H17NO2/c1-3-9-13(10-4-2)12(15)7-5-11(14)6-8-12/h3-7,14-15H,1-2,8-10H2 |
| InChIKey | AQBGPPBQBRMYLZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol?
The IUPAC name of 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol (CID 69194228) is 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol.
What is the SMILES notation for 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol?
The canonical SMILES for 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol is C=CCN(CC=C)C1(O)C=CC(O)=CC1.
What is the InChIKey of 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol?
The InChIKey is AQBGPPBQBRMYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-3-9-13(10-4-2)12(15)7-5-11(14)6-8-12/h3-7,14-15H,1-2,8-10H2.
What are the key properties of 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol?
4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol has a molecular weight of 207.27 g/mol, XLogP of 1.75, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(prop-2-enyl)amino]cyclohexa-1,5-diene-1,4-diol is sourced from PubChem (CID 69194228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).