C22H29N5O3 — CID 69194574
benzyl 4-[5-(dimethylcarbamoyl)pyrazin-2-yl]-2-propan-2-ylpiperazine-1-carboxylate (PubChem CID 69194574) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is benzyl 4-[5-(dimethylcarbamoyl)pyrazin-2-yl]-2-propan-2-ylpiperazine-1-carboxylate.
| Compound Name | benzyl 4-[5-(dimethylcarbamoyl)pyrazin-2-yl]-2-propan-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 69194574 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | benzyl 4-[5-(dimethylcarbamoyl)pyrazin-2-yl]-2-propan-2-ylpiperazine-1-carboxylate |
| SMILES | CC(C)C1CN(c2cnc(C(=O)N(C)C)cn2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H29N5O3/c1-16(2)19-14-26(20-13-23-18(12-24-20)21(28)25(3)4)10-11-27(19)22(29)30-15-17-8-6-5-7-9-17/h5-9,12-13,16,19H,10-11,14-15H2,1-4H3 |
| InChIKey | CAHQGKAFJYCLPN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |