C15H16N4O — CID 69194624
13,16-dimethyl-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-9-amine (PubChem CID 69194624) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 13,16-dimethyl-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-9-amine.
| Compound Name | 13,16-dimethyl-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-9-amine |
|---|---|
| PubChem CID | 69194624 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 13,16-dimethyl-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-9-amine |
| SMILES | CC1OCC(C)n2c1nc1c(N)nc3ccccc3c12 |
| InChI | InChI=1S/C15H16N4O/c1-8-7-20-9(2)15-18-12-13(19(8)15)10-5-3-4-6-11(10)17-14(12)16/h3-6,8-9H,7H2,1-2H3,(H2,16,17) |
| InChIKey | PZAJUXBOJOJQJE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |