C22H25FN4O3S2 — CID 69194665
N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-4-fluoro-2-methoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide (PubChem CID 69194665) has the molecular formula C22H25FN4O3S2 and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-4-fluoro-2-methoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide.
| Compound Name | N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-4-fluoro-2-methoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 69194665 |
| Molecular Formula | C22H25FN4O3S2 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-4-fluoro-2-methoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
| SMILES | COc1cc(F)c(N2C[C@@H](C)N[C@@H](C)C2)cc1NS(=O)(=O)c1ccc(-c2ccccn2)s1 |
| InChI | InChI=1S/C22H25FN4O3S2/c1-14-12-27(13-15(2)25-14)19-11-18(20(30-3)10-16(19)23)26-32(28,29)22-8-7-21(31-22)17-6-4-5-9-24-17/h4-11,14-15,25-26H,12-13H2,1-3H3/t14-,15+ |
| InChIKey | LQJHZUUEYBGITC-GASCZTMLSA-N |
| XLogP | 3.95 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|