About (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate
(4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate (PubChem CID 69194887) has the molecular formula C21H31BrN2O3
and a molecular weight of 439.39 g/mol. Its IUPAC name is (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate.
Molecular Properties
| Compound Name | (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate |
| PubChem CID | 69194887 |
| Molecular Formula | C21H31BrN2O3 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate |
| SMILES | C=CCN(C)CCCOC1CCC(N(C)C(=O)Oc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C21H31BrN2O3/c1-4-14-23(2)15-5-16-26-19-12-8-18(9-13-19)24(3)21(25)27-20-10-6-17(22)7-11-20/h4,6-7,10-11,18-19H,1,5,8-9,12-16H2,2-3H3 |
| InChIKey | ZGJUXSLHSJTLOA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate?
The IUPAC name of (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate (CID 69194887) is (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate.
What is the SMILES notation for (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate?
The canonical SMILES for (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate is C=CCN(C)CCCOC1CCC(N(C)C(=O)Oc2ccc(Br)cc2)CC1.
What is the InChIKey of (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate?
The InChIKey is ZGJUXSLHSJTLOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31BrN2O3/c1-4-14-23(2)15-5-16-26-19-12-8-18(9-13-19)24(3)21(25)27-20-10-6-17(22)7-11-20/h4,6-7,10-11,18-19H,1,5,8-9,12-16H2,2-3H3.
What are the key properties of (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate?
(4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate has a molecular weight of 439.39 g/mol, XLogP of 4.72, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl) N-methyl-N-[4-[3-[methyl(prop-2-enyl)amino]propoxy]cyclohexyl]carbamate is sourced from PubChem (CID 69194887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).