About 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene
1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene (PubChem CID 69195462) has the molecular formula C13H15F2NO3
and a molecular weight of 271.26 g/mol. Its IUPAC name is 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene.
Molecular Properties
| Compound Name | 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene |
| PubChem CID | 69195462 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene |
| SMILES | CC(C)[C@@H](/C=C/[N+](=O)[O-])OCc1c(F)cccc1F |
| InChI | InChI=1S/C13H15F2NO3/c1-9(2)13(6-7-16(17)18)19-8-10-11(14)4-3-5-12(10)15/h3-7,9,13H,8H2,1-2H3/b7-6+/t13-/m1/s1 |
| InChIKey | GAYILPUJUULKJL-KTRBRXNASA-N |
| XLogP | 3.30 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene?
The IUPAC name of 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene (CID 69195462) is 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene.
What is the SMILES notation for 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene?
The canonical SMILES for 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene is CC(C)[C@@H](/C=C/[N+](=O)[O-])OCc1c(F)cccc1F.
What is the InChIKey of 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene?
The InChIKey is GAYILPUJUULKJL-KTRBRXNASA-N. The full InChI is InChI=1S/C13H15F2NO3/c1-9(2)13(6-7-16(17)18)19-8-10-11(14)4-3-5-12(10)15/h3-7,9,13H,8H2,1-2H3/b7-6+/t13-/m1/s1.
What are the key properties of 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene?
1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene has a molecular weight of 271.26 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-2-[[(E,3S)-4-methyl-1-nitropent-1-en-3-yl]oxymethyl]benzene is sourced from PubChem (CID 69195462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).