About methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate
methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 69195739) has the molecular formula C26H20F3NO6
and a molecular weight of 499.44 g/mol. Its IUPAC name is methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate |
| PubChem CID | 69195739 |
| Molecular Formula | C26H20F3NO6 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | COC(=O)c1ccc(OCCCON2C(=O)c3ccccc3C2=O)c(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C26H20F3NO6/c1-34-25(33)17-9-12-22(21(15-17)16-7-10-18(11-8-16)26(27,28)29)35-13-4-14-36-30-23(31)19-5-2-3-6-20(19)24(30)32/h2-3,5-12,15H,4,13-14H2,1H3 |
| InChIKey | HTYSBBSHMKPRBG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate?
The IUPAC name of methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate (CID 69195739) is methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate.
What is the SMILES notation for methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate?
The canonical SMILES for methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate is COC(=O)c1ccc(OCCCON2C(=O)c3ccccc3C2=O)c(-c2ccc(C(F)(F)F)cc2)c1.
What is the InChIKey of methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate?
The InChIKey is HTYSBBSHMKPRBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20F3NO6/c1-34-25(33)17-9-12-22(21(15-17)16-7-10-18(11-8-16)26(27,28)29)35-13-4-14-36-30-23(31)19-5-2-3-6-20(19)24(30)32/h2-3,5-12,15H,4,13-14H2,1H3.
What are the key properties of methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate?
methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate has a molecular weight of 499.44 g/mol, XLogP of 5.16, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-3-[4-(trifluoromethyl)phenyl]benzoate is sourced from PubChem (CID 69195739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).