About (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate
(3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate (PubChem CID 69195987) has the molecular formula C23H36F2N2O3
and a molecular weight of 426.55 g/mol. Its IUPAC name is (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate |
| PubChem CID | 69195987 |
| Molecular Formula | C23H36F2N2O3 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate |
| SMILES | CCN(CCO)CCCCCC1CCC(N(C)C(=O)Oc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C23H36F2N2O3/c1-3-27(15-16-28)14-6-4-5-7-18-8-10-19(11-9-18)26(2)23(29)30-20-12-13-21(24)22(25)17-20/h12-13,17-19,28H,3-11,14-16H2,1-2H3 |
| InChIKey | GNUQXUUSDGVWBN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate?
The IUPAC name of (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate (CID 69195987) is (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate.
What is the SMILES notation for (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate?
The canonical SMILES for (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate is CCN(CCO)CCCCCC1CCC(N(C)C(=O)Oc2ccc(F)c(F)c2)CC1.
What is the InChIKey of (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate?
The InChIKey is GNUQXUUSDGVWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36F2N2O3/c1-3-27(15-16-28)14-6-4-5-7-18-8-10-19(11-9-18)26(2)23(29)30-20-12-13-21(24)22(25)17-20/h12-13,17-19,28H,3-11,14-16H2,1-2H3.
What are the key properties of (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate?
(3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate has a molecular weight of 426.55 g/mol, XLogP of 4.83, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorophenyl) N-[4-[5-[ethyl(2-hydroxyethyl)amino]pentyl]cyclohexyl]-N-methylcarbamate is sourced from PubChem (CID 69195987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).