About 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid
4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid (PubChem CID 69197464) has the molecular formula C26H24FNO2
and a molecular weight of 401.48 g/mol. Its IUPAC name is 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid.
Molecular Properties
| Compound Name | 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid |
| PubChem CID | 69197464 |
| Molecular Formula | C26H24FNO2 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid |
| SMILES | CC1(C)CC=C(c2ccccc2)c2cc(CNc3ccc(C(=O)O)cc3F)ccc21 |
| InChI | InChI=1S/C26H24FNO2/c1-26(2)13-12-20(18-6-4-3-5-7-18)21-14-17(8-10-22(21)26)16-28-24-11-9-19(25(29)30)15-23(24)27/h3-12,14-15,28H,13,16H2,1-2H3,(H,29,30) |
| InChIKey | ODZUINIMBVVGSH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid?
The IUPAC name of 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid (CID 69197464) is 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid.
What is the SMILES notation for 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid?
The canonical SMILES for 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid is CC1(C)CC=C(c2ccccc2)c2cc(CNc3ccc(C(=O)O)cc3F)ccc21.
What is the InChIKey of 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid?
The InChIKey is ODZUINIMBVVGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24FNO2/c1-26(2)13-12-20(18-6-4-3-5-7-18)21-14-17(8-10-22(21)26)16-28-24-11-9-19(25(29)30)15-23(24)27/h3-12,14-15,28H,13,16H2,1-2H3,(H,29,30).
What are the key properties of 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid?
4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid has a molecular weight of 401.48 g/mol, XLogP of 6.25, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)methylamino]-3-fluorobenzoic acid is sourced from PubChem (CID 69197464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).