About N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide
N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide (PubChem CID 69198286) has the molecular formula C20H23N3O2S2
and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide |
| PubChem CID | 69198286 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide |
| SMILES | C[C@@H]1CN(c2cccc(NS(=O)(=O)c3cc4ccccc4s3)c2)C[C@H](C)N1 |
| InChI | InChI=1S/C20H23N3O2S2/c1-14-12-23(13-15(2)21-14)18-8-5-7-17(11-18)22-27(24,25)20-10-16-6-3-4-9-19(16)26-20/h3-11,14-15,21-22H,12-13H2,1-2H3/t14-,15+ |
| InChIKey | MUBPGSWJVHKKOJ-GASCZTMLSA-N |
| XLogP | 3.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide?
The IUPAC name of N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide (CID 69198286) is N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide.
What is the SMILES notation for N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide?
The canonical SMILES for N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide is C[C@@H]1CN(c2cccc(NS(=O)(=O)c3cc4ccccc4s3)c2)C[C@H](C)N1.
What is the InChIKey of N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide?
The InChIKey is MUBPGSWJVHKKOJ-GASCZTMLSA-N. The full InChI is InChI=1S/C20H23N3O2S2/c1-14-12-23(13-15(2)21-14)18-8-5-7-17(11-18)22-27(24,25)20-10-16-6-3-4-9-19(16)26-20/h3-11,14-15,21-22H,12-13H2,1-2H3/t14-,15+.
What are the key properties of N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide?
N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide has a molecular weight of 401.56 g/mol, XLogP of 3.89, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1-benzothiophene-2-sulfonamide is sourced from PubChem (CID 69198286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).