C36H46N2O7S — CID 69198422
N-benzyl-3-[4-[6-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]hexoxy]butyl]benzenesulfonamide (PubChem CID 69198422) has the molecular formula C36H46N2O7S and a molecular weight of 650.84 g/mol. Its IUPAC name is N-benzyl-3-[4-[6-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]hexoxy]butyl]benzenesulfonamide.
| Compound Name | N-benzyl-3-[4-[6-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]hexoxy]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69198422 |
| Molecular Formula | C36H46N2O7S |
| Molecular Weight | 650.84 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | N-benzyl-3-[4-[6-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]hexoxy]butyl]benzenesulfonamide |
| SMILES | CC1(C)OCc2cc([C@@H]3CN(CCCCCCOCCCCc4cccc(S(=O)(=O)NCc5ccccc5)c4)C(=O)O3)ccc2O1 |
| InChI | InChI=1S/C36H46N2O7S/c1-36(2)43-27-31-24-30(18-19-33(31)45-36)34-26-38(35(39)44-34)20-9-3-4-10-21-42-22-11-8-13-28-16-12-17-32(23-28)46(40,41)37-25-29-14-6-5-7-15-29/h5-7,12,14-19,23-24,34,37H,3-4,8-11,13,20-22,25-27H2,1-2H3/t34-/m0/s1 |
| InChIKey | XOZYSVRZVAKKRB-UMSFTDKQSA-N |
| XLogP | 6.90 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.84 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|