C14H17F2NO3 — CID 69198628
1,2-difluoro-3-[[(E,3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene (PubChem CID 69198628) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 1,2-difluoro-3-[[(E,3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene.
| Compound Name | 1,2-difluoro-3-[[(E,3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene |
|---|---|
| PubChem CID | 69198628 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1,2-difluoro-3-[[(E,3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene |
| SMILES | CC[C@H](C)[C@@H](/C=C/[N+](=O)[O-])OCc1cccc(F)c1F |
| InChI | InChI=1S/C14H17F2NO3/c1-3-10(2)13(7-8-17(18)19)20-9-11-5-4-6-12(15)14(11)16/h4-8,10,13H,3,9H2,1-2H3/b8-7+/t10-,13+/m0/s1 |
| InChIKey | PAUHGRMHPXIHTP-YGSRZLQPSA-N |
| XLogP | 3.69 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|