About 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene
1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene (PubChem CID 69198638) has the molecular formula C14H17F2NO3
and a molecular weight of 285.29 g/mol. Its IUPAC name is 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene.
Molecular Properties
| Compound Name | 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene |
| PubChem CID | 69198638 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene |
| SMILES | CC[C@H](C)[C@@H](C=C[N+](=O)[O-])OCc1cccc(F)c1F |
| InChI | InChI=1S/C14H17F2NO3/c1-3-10(2)13(7-8-17(18)19)20-9-11-5-4-6-12(15)14(11)16/h4-8,10,13H,3,9H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | PAUHGRMHPXIHTP-GXFFZTMASA-N |
| XLogP | 3.69 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene?
The IUPAC name of 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene (CID 69198638) is 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene.
What is the SMILES notation for 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene?
The canonical SMILES for 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene is CC[C@H](C)[C@@H](C=C[N+](=O)[O-])OCc1cccc(F)c1F.
What is the InChIKey of 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene?
The InChIKey is PAUHGRMHPXIHTP-GXFFZTMASA-N. The full InChI is InChI=1S/C14H17F2NO3/c1-3-10(2)13(7-8-17(18)19)20-9-11-5-4-6-12(15)14(11)16/h4-8,10,13H,3,9H2,1-2H3/t10-,13+/m0/s1.
What are the key properties of 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene?
1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene has a molecular weight of 285.29 g/mol, XLogP of 3.69, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-3-[[(3S,4S)-4-methyl-1-nitrohex-1-en-3-yl]oxymethyl]benzene is sourced from PubChem (CID 69198638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).