About 1,3,4-trimethylphenazin-2-amine;hydrochloride
1,3,4-trimethylphenazin-2-amine;hydrochloride (PubChem CID 69198812) has the molecular formula C15H16ClN3
and a molecular weight of 273.77 g/mol. Its IUPAC name is 1,3,4-trimethylphenazin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 1,3,4-trimethylphenazin-2-amine;hydrochloride |
| PubChem CID | 69198812 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1,3,4-trimethylphenazin-2-amine;hydrochloride |
| SMILES | Cc1c(N)c(C)c2nc3ccccc3nc2c1C.Cl |
| InChI | InChI=1S/C15H15N3.ClH/c1-8-9(2)14-15(10(3)13(8)16)18-12-7-5-4-6-11(12)17-14;/h4-7H,16H2,1-3H3;1H |
| InChIKey | PJPOKWKBZZXRMT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3,4-trimethylphenazin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4-trimethylphenazin-2-amine;hydrochloride?
The IUPAC name of 1,3,4-trimethylphenazin-2-amine;hydrochloride (CID 69198812) is 1,3,4-trimethylphenazin-2-amine;hydrochloride.
What is the SMILES notation for 1,3,4-trimethylphenazin-2-amine;hydrochloride?
The canonical SMILES for 1,3,4-trimethylphenazin-2-amine;hydrochloride is Cc1c(N)c(C)c2nc3ccccc3nc2c1C.Cl.
What is the InChIKey of 1,3,4-trimethylphenazin-2-amine;hydrochloride?
The InChIKey is PJPOKWKBZZXRMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3.ClH/c1-8-9(2)14-15(10(3)13(8)16)18-12-7-5-4-6-11(12)17-14;/h4-7H,16H2,1-3H3;1H.
What are the key properties of 1,3,4-trimethylphenazin-2-amine;hydrochloride?
1,3,4-trimethylphenazin-2-amine;hydrochloride has a molecular weight of 273.77 g/mol, XLogP of 3.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4-trimethylphenazin-2-amine;hydrochloride is sourced from PubChem (CID 69198812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).