About 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole
5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole (PubChem CID 69198989) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole |
| PubChem CID | 69198989 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole |
| SMILES | C1=CCCC(C2=CCCN2C2CCCCC2)=C1 |
| InChI | InChI=1S/C16H23N/c1-3-8-14(9-4-1)16-12-7-13-17(16)15-10-5-2-6-11-15/h1,3,8,12,15H,2,4-7,9-11,13H2 |
| InChIKey | WNNCVRZGVZZGLE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole?
The IUPAC name of 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole (CID 69198989) is 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole.
What is the SMILES notation for 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole?
The canonical SMILES for 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole is C1=CCCC(C2=CCCN2C2CCCCC2)=C1.
What is the InChIKey of 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole?
The InChIKey is WNNCVRZGVZZGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N/c1-3-8-14(9-4-1)16-12-7-13-17(16)15-10-5-2-6-11-15/h1,3,8,12,15H,2,4-7,9-11,13H2.
What are the key properties of 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole?
5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole has a molecular weight of 229.37 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexa-1,3-dien-1-yl-1-cyclohexyl-2,3-dihydropyrrole is sourced from PubChem (CID 69198989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).