C30H38N2O7S — CID 69199461
3-[5-[6-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]hexoxy]pent-1-ynyl]benzenesulfonamide (PubChem CID 69199461) has the molecular formula C30H38N2O7S and a molecular weight of 570.71 g/mol. Its IUPAC name is 3-[5-[6-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]hexoxy]pent-1-ynyl]benzenesulfonamide.
| Compound Name | 3-[5-[6-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]hexoxy]pent-1-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69199461 |
| Molecular Formula | C30H38N2O7S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 3-[5-[6-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]hexoxy]pent-1-ynyl]benzenesulfonamide |
| SMILES | CC1(C)OCc2cc([C@@H]3CN(CCCCCCOCCCC#Cc4cccc(S(N)(=O)=O)c4)C(=O)O3)ccc2O1 |
| InChI | InChI=1S/C30H38N2O7S/c1-30(2)37-22-25-20-24(14-15-27(25)39-30)28-21-32(29(33)38-28)16-7-3-4-8-17-36-18-9-5-6-11-23-12-10-13-26(19-23)40(31,34)35/h10,12-15,19-20,28H,3-5,7-9,16-18,21-22H2,1-2H3,(H2,31,34,35)/t28-/m0/s1 |
| InChIKey | GAKJPWKDZYTRQS-NDEPHWFRSA-N |
| XLogP | 4.88 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|