About 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane]
5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] (PubChem CID 69199578) has the molecular formula C11H10BrFO2
and a molecular weight of 273.10 g/mol. Its IUPAC name is 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane].
Molecular Properties
| Compound Name | 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] |
| PubChem CID | 69199578 |
| Molecular Formula | C11H10BrFO2 |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] |
| SMILES | Fc1cc(Br)cc2c1CCC21OCCO1 |
| InChI | InChI=1S/C11H10BrFO2/c12-7-5-9-8(10(13)6-7)1-2-11(9)14-3-4-15-11/h5-6H,1-4H2 |
| InChIKey | HMWRCZJUDJZYTI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane]?
The IUPAC name of 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] (CID 69199578) is 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane].
What is the SMILES notation for 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane]?
The canonical SMILES for 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] is Fc1cc(Br)cc2c1CCC21OCCO1.
What is the InChIKey of 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane]?
The InChIKey is HMWRCZJUDJZYTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrFO2/c12-7-5-9-8(10(13)6-7)1-2-11(9)14-3-4-15-11/h5-6H,1-4H2.
What are the key properties of 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane]?
5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] has a molecular weight of 273.10 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-7-fluorospiro[1,2-dihydroindene-3,2'-1,3-dioxolane] is sourced from PubChem (CID 69199578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).