C31H30N2O7S — CID 69199761
4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]phenyl]benzoic acid (PubChem CID 69199761) has the molecular formula C31H30N2O7S and a molecular weight of 574.66 g/mol. Its IUPAC name is 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]phenyl]benzoic acid.
| Compound Name | 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 69199761 |
| Molecular Formula | C31H30N2O7S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]phenyl]benzoic acid |
| SMILES | C[C@H](NCCOc1ccc(-c2ccc(C(=O)O)cc2)cc1)[C@H](O)c1ccc2cc1NS(=O)(=O)c1cccc(c1)CO2 |
| InChI | InChI=1S/C31H30N2O7S/c1-20(32-15-16-39-25-11-9-23(10-12-25)22-5-7-24(8-6-22)31(35)36)30(34)28-14-13-26-18-29(28)33-41(37,38)27-4-2-3-21(17-27)19-40-26/h2-14,17-18,20,30,32-34H,15-16,19H2,1H3,(H,35,36)/t20-,30-/m0/s1 |
| InChIKey | LCKGZYAMXHHPLJ-WRGVRERRSA-N |
| XLogP | 4.84 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|