C18H29NO2 — CID 6919995
2-[[(1R,3S)-3-ethyl-2,2-dimethylcyclobutyl]methyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 6919995) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[[(1R,3S)-3-ethyl-2,2-dimethylcyclobutyl]methyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[[(1R,3S)-3-ethyl-2,2-dimethylcyclobutyl]methyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 6919995 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-[[(1R,3S)-3-ethyl-2,2-dimethylcyclobutyl]methyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC[C@H]1C[C@@H](C/N=C/C2C(=O)CC(C)(C)CC2=O)C1(C)C |
| InChI | InChI=1S/C18H29NO2/c1-6-12-7-13(18(12,4)5)10-19-11-14-15(20)8-17(2,3)9-16(14)21/h11-14H,6-10H2,1-5H3/b19-11+/t12-,13-/m0/s1 |
| InChIKey | BOGCDJZTFYILHV-VTCVBAAXSA-N |
| XLogP | 3.70 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|