C33H36N2O7S — CID 69200099
methane;methyl 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]phenyl]benzoate (PubChem CID 69200099) has the molecular formula C33H36N2O7S and a molecular weight of 604.73 g/mol. Its IUPAC name is methane;methyl 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]phenyl]benzoate.
| Compound Name | methane;methyl 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 69200099 |
| Molecular Formula | C33H36N2O7S |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | methane;methyl 4-[4-[2-[[(1R,2S)-1-(2,2-dioxo-9-oxa-2λ6-thia-3-azatricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaen-5-yl)-1-hydroxypropan-2-yl]amino]ethoxy]phenyl]benzoate |
| SMILES | C.COC(=O)c1ccc(-c2ccc(OCCN[C@@H](C)[C@H](O)c3ccc4cc3NS(=O)(=O)c3cccc(c3)CO4)cc2)cc1 |
| InChI | InChI=1S/C32H32N2O7S.CH4/c1-21(33-16-17-40-26-12-10-24(11-13-26)23-6-8-25(9-7-23)32(36)39-2)31(35)29-15-14-27-19-30(29)34-42(37,38)28-5-3-4-22(18-28)20-41-27;/h3-15,18-19,21,31,33-35H,16-17,20H2,1-2H3;1H4/t21-,31-;/m0./s1 |
| InChIKey | MHXCXPFANMTRJT-JACXDMRLSA-N |
| XLogP | 5.56 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|