About 2-isoquinolin-4-ylacetic acid;hydrochloride
2-isoquinolin-4-ylacetic acid;hydrochloride (PubChem CID 69200199) has the molecular formula C11H10ClNO2
and a molecular weight of 223.66 g/mol. Its IUPAC name is 2-isoquinolin-4-ylacetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-isoquinolin-4-ylacetic acid;hydrochloride |
| PubChem CID | 69200199 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 2-isoquinolin-4-ylacetic acid;hydrochloride |
| SMILES | Cl.O=C(O)Cc1cncc2ccccc12 |
| InChI | InChI=1S/C11H9NO2.ClH/c13-11(14)5-9-7-12-6-8-3-1-2-4-10(8)9;/h1-4,6-7H,5H2,(H,13,14);1H |
| InChIKey | KCAQWNKLRHEAMQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-isoquinolin-4-ylacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isoquinolin-4-ylacetic acid;hydrochloride?
The IUPAC name of 2-isoquinolin-4-ylacetic acid;hydrochloride (CID 69200199) is 2-isoquinolin-4-ylacetic acid;hydrochloride.
What is the SMILES notation for 2-isoquinolin-4-ylacetic acid;hydrochloride?
The canonical SMILES for 2-isoquinolin-4-ylacetic acid;hydrochloride is Cl.O=C(O)Cc1cncc2ccccc12.
What is the InChIKey of 2-isoquinolin-4-ylacetic acid;hydrochloride?
The InChIKey is KCAQWNKLRHEAMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2.ClH/c13-11(14)5-9-7-12-6-8-3-1-2-4-10(8)9;/h1-4,6-7H,5H2,(H,13,14);1H.
What are the key properties of 2-isoquinolin-4-ylacetic acid;hydrochloride?
2-isoquinolin-4-ylacetic acid;hydrochloride has a molecular weight of 223.66 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isoquinolin-4-ylacetic acid;hydrochloride is sourced from PubChem (CID 69200199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).