C24H27BN2O2 — CID 69200545
1-ethyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indole-6-carbonitrile (PubChem CID 69200545) has the molecular formula C24H27BN2O2 and a molecular weight of 386.30 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indole-6-carbonitrile.
| Compound Name | 1-ethyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indole-6-carbonitrile |
|---|---|
| PubChem CID | 69200545 |
| Molecular Formula | C24H27BN2O2 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-ethyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indole-6-carbonitrile |
| SMILES | CCn1cc(Cc2ccccc2B2OC(C)(C)C(C)(C)O2)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C24H27BN2O2/c1-6-27-16-19(20-12-11-17(15-26)13-22(20)27)14-18-9-7-8-10-21(18)25-28-23(2,3)24(4,5)29-25/h7-13,16H,6,14H2,1-5H3 |
| InChIKey | LUEZRXFQRBKLGJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|