C20H22FN3O4S — CID 69200608
N-[1-[3-[(5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yl)oxy]phenyl]-1-fluoroethyl]acetamide (PubChem CID 69200608) has the molecular formula C20H22FN3O4S and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[1-[3-[(5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yl)oxy]phenyl]-1-fluoroethyl]acetamide.
| Compound Name | N-[1-[3-[(5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yl)oxy]phenyl]-1-fluoroethyl]acetamide |
|---|---|
| PubChem CID | 69200608 |
| Molecular Formula | C20H22FN3O4S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[1-[3-[(5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yl)oxy]phenyl]-1-fluoroethyl]acetamide |
| SMILES | CC(=O)NC(C)(F)c1cccc(Oc2ccc3c(c2)S(=O)(=O)NC2CCCN32)c1 |
| InChI | InChI=1S/C20H22FN3O4S/c1-13(25)22-20(2,21)14-5-3-6-15(11-14)28-16-8-9-17-18(12-16)29(26,27)23-19-7-4-10-24(17)19/h3,5-6,8-9,11-12,19,23H,4,7,10H2,1-2H3,(H,22,25) |
| InChIKey | TZUIXWBDLKTELV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|