C13H14O2 — CID 69200779
6-ethenylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane] (PubChem CID 69200779) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 6-ethenylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane].
| Compound Name | 6-ethenylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 69200779 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 6-ethenylspiro[1,2-dihydroindene-3,2'-1,3-dioxolane] |
| SMILES | C=Cc1ccc2c(c1)CCC21OCCO1 |
| InChI | InChI=1S/C13H14O2/c1-2-10-3-4-12-11(9-10)5-6-13(12)14-7-8-15-13/h2-4,9H,1,5-8H2 |
| InChIKey | CBKSZCQTQLPSKA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |