C27H23F3N2O8 — CID 69201366
3,10,11,12a-tetrahydroxy-1,12-dioxo-9-[[3-(trifluoromethyl)benzoyl]amino]-2,3,4,4a,5,6-hexahydrotetracene-5a-carboxamide (PubChem CID 69201366) has the molecular formula C27H23F3N2O8 and a molecular weight of 560.48 g/mol. Its IUPAC name is 3,10,11,12a-tetrahydroxy-1,12-dioxo-9-[[3-(trifluoromethyl)benzoyl]amino]-2,3,4,4a,5,6-hexahydrotetracene-5a-carboxamide.
| Compound Name | 3,10,11,12a-tetrahydroxy-1,12-dioxo-9-[[3-(trifluoromethyl)benzoyl]amino]-2,3,4,4a,5,6-hexahydrotetracene-5a-carboxamide |
|---|---|
| PubChem CID | 69201366 |
| Molecular Formula | C27H23F3N2O8 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 3,10,11,12a-tetrahydroxy-1,12-dioxo-9-[[3-(trifluoromethyl)benzoyl]amino]-2,3,4,4a,5,6-hexahydrotetracene-5a-carboxamide |
| SMILES | NC(=O)C12Cc3ccc(NC(=O)c4cccc(C(F)(F)F)c4)c(O)c3C(O)=C1C(=O)C1(O)C(=O)CC(O)CC1C2 |
| InChI | InChI=1S/C27H23F3N2O8/c28-27(29,30)13-3-1-2-11(6-13)23(38)32-16-5-4-12-9-25(24(31)39)10-14-7-15(33)8-17(34)26(14,40)22(37)19(25)21(36)18(12)20(16)35/h1-6,14-15,33,35-36,40H,7-10H2,(H2,31,39)(H,32,38) |
| InChIKey | ULFQFICZISTMCU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 187.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|