C17H18N4O2S2 — CID 69201511
6-benzylsulfanyl-5-(1,4,5,6-tetrahydropyrimidin-2-yl)imidazo[2,1-b][1,3]thiazole;formic acid (PubChem CID 69201511) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 6-benzylsulfanyl-5-(1,4,5,6-tetrahydropyrimidin-2-yl)imidazo[2,1-b][1,3]thiazole;formic acid.
| Compound Name | 6-benzylsulfanyl-5-(1,4,5,6-tetrahydropyrimidin-2-yl)imidazo[2,1-b][1,3]thiazole;formic acid |
|---|---|
| PubChem CID | 69201511 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 6-benzylsulfanyl-5-(1,4,5,6-tetrahydropyrimidin-2-yl)imidazo[2,1-b][1,3]thiazole;formic acid |
| SMILES | O=CO.c1ccc(CSc2nc3sccn3c2C2=NCCCN2)cc1 |
| InChI | InChI=1S/C16H16N4S2.CH2O2/c1-2-5-12(6-3-1)11-22-15-13(14-17-7-4-8-18-14)20-9-10-21-16(20)19-15;2-1-3/h1-3,5-6,9-10H,4,7-8,11H2,(H,17,18);1H,(H,2,3) |
| InChIKey | YSDKFIGKMJFVIX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|