About 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile
2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile (PubChem CID 69202093) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile |
| PubChem CID | 69202093 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile |
| SMILES | N#CCc1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C11H9NO/c12-6-5-8-1-2-9-3-4-11(13)10(9)7-8/h1-2,7H,3-5H2 |
| InChIKey | ICEIKPGOSBJXDC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile?
The IUPAC name of 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile (CID 69202093) is 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile.
What is the SMILES notation for 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile?
The canonical SMILES for 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile is N#CCc1ccc2c(c1)C(=O)CC2.
What is the InChIKey of 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile?
The InChIKey is ICEIKPGOSBJXDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c12-6-5-8-1-2-9-3-4-11(13)10(9)7-8/h1-2,7H,3-5H2.
What are the key properties of 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile?
2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile has a molecular weight of 171.20 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-1,2-dihydroinden-5-yl)acetonitrile is sourced from PubChem (CID 69202093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).