About pyridine-2-carboxylate
pyridine-2-carboxylate (PubChem CID 6920223) has the molecular formula C6H4NO2-
and a molecular weight of 122.10 g/mol. Its IUPAC name is pyridine-2-carboxylate.
Molecular Properties
| Compound Name | pyridine-2-carboxylate |
| PubChem CID | 6920223 |
| Molecular Formula | C6H4NO2- |
| Molecular Weight | 122.10 g/mol |
| Exact Mass | 122.02 |
| IUPAC Name | pyridine-2-carboxylate |
| SMILES | O=C([O-])c1ccccn1 |
| InChI | InChI=1S/C6H5NO2/c8-6(9)5-3-1-2-4-7-5/h1-4H,(H,8,9)/p-1 |
| InChIKey | SIOXPEMLGUPBBT-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.10 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2-carboxylate?
The IUPAC name of pyridine-2-carboxylate (CID 6920223) is pyridine-2-carboxylate.
What is the SMILES notation for pyridine-2-carboxylate?
The canonical SMILES for pyridine-2-carboxylate is O=C([O-])c1ccccn1.
What is the InChIKey of pyridine-2-carboxylate?
The InChIKey is SIOXPEMLGUPBBT-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO2/c8-6(9)5-3-1-2-4-7-5/h1-4H,(H,8,9)/p-1.
What are the key properties of pyridine-2-carboxylate?
pyridine-2-carboxylate has a molecular weight of 122.10 g/mol, XLogP of -0.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2-carboxylate is sourced from PubChem (CID 6920223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).