About 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene
1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene (PubChem CID 69202629) has the molecular formula C19H22O4
and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene.
Molecular Properties
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene |
| PubChem CID | 69202629 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene |
| SMILES | CC=C(c1cc(OC)cc(OC)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22O4/c1-6-17(13-7-8-18(22-4)19(11-13)23-5)14-9-15(20-2)12-16(10-14)21-3/h6-12H,1-5H3 |
| InChIKey | NKEKHUQLJHIYAW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene?
The IUPAC name of 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene (CID 69202629) is 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene.
What is the SMILES notation for 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene?
The canonical SMILES for 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene is CC=C(c1cc(OC)cc(OC)c1)c1ccc(OC)c(OC)c1.
What is the InChIKey of 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene?
The InChIKey is NKEKHUQLJHIYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O4/c1-6-17(13-7-8-18(22-4)19(11-13)23-5)14-9-15(20-2)12-16(10-14)21-3/h6-12H,1-5H3.
What are the key properties of 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene?
1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene has a molecular weight of 314.38 g/mol, XLogP of 4.17, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,4-dimethoxyphenyl)prop-1-enyl]-3,5-dimethoxybenzene is sourced from PubChem (CID 69202629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).