C10H17N3O2S+2 — CID 6920321
1-methyl-4-[(5-nitrothiophen-2-yl)methyl]piperazine-1,4-diium (PubChem CID 6920321) has the molecular formula C10H17N3O2S+2 and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-methyl-4-[(5-nitrothiophen-2-yl)methyl]piperazine-1,4-diium.
| Compound Name | 1-methyl-4-[(5-nitrothiophen-2-yl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6920321 |
| Molecular Formula | C10H17N3O2S+2 |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-methyl-4-[(5-nitrothiophen-2-yl)methyl]piperazine-1,4-diium |
| SMILES | C[NH+]1CC[NH+](Cc2ccc([N+](=O)[O-])s2)CC1 |
| InChI | InChI=1S/C10H15N3O2S/c1-11-4-6-12(7-5-11)8-9-2-3-10(16-9)13(14)15/h2-3H,4-8H2,1H3/p+2 |
| InChIKey | MONUCAGHYAVLMP-UHFFFAOYSA-P |
| XLogP | -1.43 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|