C21H15ClFIN4O4S2 — CID 69204458
1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[7-fluoro-3-iodo-6-(methylamino)-1-oxoisoquinolin-2-yl]phenyl]urea (PubChem CID 69204458) has the molecular formula C21H15ClFIN4O4S2 and a molecular weight of 632.86 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[7-fluoro-3-iodo-6-(methylamino)-1-oxoisoquinolin-2-yl]phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[7-fluoro-3-iodo-6-(methylamino)-1-oxoisoquinolin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 69204458 |
| Molecular Formula | C21H15ClFIN4O4S2 |
| Molecular Weight | 632.86 g/mol |
| Exact Mass | 631.93 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[7-fluoro-3-iodo-6-(methylamino)-1-oxoisoquinolin-2-yl]phenyl]urea |
| SMILES | CNc1cc2cc(I)n(-c3ccc(NC(=O)NS(=O)(=O)c4ccc(Cl)s4)cc3)c(=O)c2cc1F |
| InChI | InChI=1S/C21H15ClFIN4O4S2/c1-25-16-8-11-9-18(24)28(20(29)14(11)10-15(16)23)13-4-2-12(3-5-13)26-21(30)27-34(31,32)19-7-6-17(22)33-19/h2-10,25H,1H3,(H2,26,27,30) |
| InChIKey | FAORCVAJKYMEOE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.86 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|