C14H22N2O3 — CID 69205224
cis-(1S,2R)-2-N-[(1S)-2-oxocyclohexyl]cyclohexane-1,2-dicarboxamide (PubChem CID 69205224) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is cis-(1S,2R)-2-N-[(1S)-2-oxocyclohexyl]cyclohexane-1,2-dicarboxamide.
| Compound Name | cis-(1S,2R)-2-N-[(1S)-2-oxocyclohexyl]cyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 69205224 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | cis-(1S,2R)-2-N-[(1S)-2-oxocyclohexyl]cyclohexane-1,2-dicarboxamide |
| SMILES | NC(=O)[C@H]1CCCC[C@H]1C(=O)N[C@H]1CCCCC1=O |
| InChI | InChI=1S/C14H22N2O3/c15-13(18)9-5-1-2-6-10(9)14(19)16-11-7-3-4-8-12(11)17/h9-11H,1-8H2,(H2,15,18)(H,16,19)/t9-,10+,11-/m0/s1 |
| InChIKey | PDWBDSMFNJMYKT-AXFHLTTASA-N |
| XLogP | 0.91 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |