C40H30Cl2N6O2 — CID 69205278
1,2-bis[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1,2-bis(4-methylphenyl)ethane-1,2-diol (PubChem CID 69205278) has the molecular formula C40H30Cl2N6O2 and a molecular weight of 697.63 g/mol. Its IUPAC name is 1,2-bis[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1,2-bis(4-methylphenyl)ethane-1,2-diol.
| Compound Name | 1,2-bis[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1,2-bis(4-methylphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 69205278 |
| Molecular Formula | C40H30Cl2N6O2 |
| Molecular Weight | 697.63 g/mol |
| Exact Mass | 696.18 |
| IUPAC Name | 1,2-bis[3-(2-chlorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1,2-bis(4-methylphenyl)ethane-1,2-diol |
| SMILES | Cc1ccc(C(O)(c2ccc3nnc(-c4ccccc4Cl)n3c2)C(O)(c2ccc(C)cc2)c2ccc3nnc(-c4ccccc4Cl)n3c2)cc1 |
| InChI | InChI=1S/C40H30Cl2N6O2/c1-25-11-15-27(16-12-25)39(49,29-19-21-35-43-45-37(47(35)23-29)31-7-3-5-9-33(31)41)40(50,28-17-13-26(2)14-18-28)30-20-22-36-44-46-38(48(36)24-30)32-8-4-6-10-34(32)42/h3-24,49-50H,1-2H3 |
| InChIKey | FWFSQSAIZYDKSO-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.63 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |