C20H23F3O4S — CID 69205717
(8R,9S,13S,14S)-2-methoxy-13-methyl-3-(trifluoromethylsulfonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 69205717) has the molecular formula C20H23F3O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-methoxy-13-methyl-3-(trifluoromethylsulfonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2-methoxy-13-methyl-3-(trifluoromethylsulfonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 69205717 |
| Molecular Formula | C20H23F3O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (8R,9S,13S,14S)-2-methoxy-13-methyl-3-(trifluoromethylsulfonyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COc1cc2c(cc1S(=O)(=O)C(F)(F)F)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H23F3O4S/c1-19-8-7-12-13(15(19)5-6-18(19)24)4-3-11-9-17(16(27-2)10-14(11)12)28(25,26)20(21,22)23/h9-10,12-13,15H,3-8H2,1-2H3/t12-,13+,15-,19-/m0/s1 |
| InChIKey | FKVBIUBQMPPTBY-QPWUGHHJSA-N |
| XLogP | 4.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |