C23H32N4OSi — CID 69207401
N-(1H-benzimidazol-2-ylmethyl)-N-(2-trimethylsilylethoxymethyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 69207401) has the molecular formula C23H32N4OSi and a molecular weight of 408.62 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-N-(2-trimethylsilylethoxymethyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-N-(2-trimethylsilylethoxymethyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 69207401 |
| Molecular Formula | C23H32N4OSi |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-N-(2-trimethylsilylethoxymethyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | C[Si](C)(C)CCOCN(Cc1nc2ccccc2[nH]1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C23H32N4OSi/c1-29(2,3)15-14-28-17-27(16-22-25-19-10-4-5-11-20(19)26-22)21-12-6-8-18-9-7-13-24-23(18)21/h4-5,7,9-11,13,21H,6,8,12,14-17H2,1-3H3,(H,25,26) |
| InChIKey | LACXMHALWLKEHD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|