C13H16N2 — CID 69207768
2-ethyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole (PubChem CID 69207768) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-ethyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-ethyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 69207768 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-ethyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole |
| SMILES | CCN1CCC2N=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H16N2/c1-2-15-8-7-13-11(9-15)10-5-3-4-6-12(10)14-13/h3-6,13H,2,7-9H2,1H3 |
| InChIKey | NTUKWZYCQHDILL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |