C23H36BrN3O2 — CID 69207998
tert-butyl 4-[4-[1-(4-bromophenyl)ethyl]-3-methylpiperazin-1-yl]piperidine-1-carboxylate (PubChem CID 69207998) has the molecular formula C23H36BrN3O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is tert-butyl 4-[4-[1-(4-bromophenyl)ethyl]-3-methylpiperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[1-(4-bromophenyl)ethyl]-3-methylpiperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69207998 |
| Molecular Formula | C23H36BrN3O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | tert-butyl 4-[4-[1-(4-bromophenyl)ethyl]-3-methylpiperazin-1-yl]piperidine-1-carboxylate |
| SMILES | CC1CN(C2CCN(C(=O)OC(C)(C)C)CC2)CCN1C(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H36BrN3O2/c1-17-16-26(14-15-27(17)18(2)19-6-8-20(24)9-7-19)21-10-12-25(13-11-21)22(28)29-23(3,4)5/h6-9,17-18,21H,10-16H2,1-5H3 |
| InChIKey | HUSMPKZBAOSVGH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |