C33H33ClN4O3 — CID 69208431
(2R)-2-[(3S,5R)-4-[2-(4-aminophenyl)acetyl]-3-(3-chlorophenyl)-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide (PubChem CID 69208431) has the molecular formula C33H33ClN4O3 and a molecular weight of 569.11 g/mol. Its IUPAC name is (2R)-2-[(3S,5R)-4-[2-(4-aminophenyl)acetyl]-3-(3-chlorophenyl)-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide.
| Compound Name | (2R)-2-[(3S,5R)-4-[2-(4-aminophenyl)acetyl]-3-(3-chlorophenyl)-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 69208431 |
| Molecular Formula | C33H33ClN4O3 |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | (2R)-2-[(3S,5R)-4-[2-(4-aminophenyl)acetyl]-3-(3-chlorophenyl)-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide |
| SMILES | C[C@@H]1CCN([C@H](Cc2cccc3ccccc23)C(N)=O)C(=O)[C@H](c2cccc(Cl)c2)N1C(=O)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C33H33ClN4O3/c1-21-16-17-37(29(32(36)40)20-24-8-4-7-23-6-2-3-11-28(23)24)33(41)31(25-9-5-10-26(34)19-25)38(21)30(39)18-22-12-14-27(35)15-13-22/h2-15,19,21,29,31H,16-18,20,35H2,1H3,(H2,36,40)/t21-,29-,31+/m1/s1 |
| InChIKey | DFXRSCXCRGRQEX-QLQSRUBLSA-N |
| XLogP | 4.91 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|