C26H26Cl2N6O2S — CID 69208451
7-(2-chlorophenyl)-8-(4-chlorophenyl)-2-methyl-4-[(1S,4S)-5-propan-2-ylsulfonyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrazolo[1,5-a][1,3,5]triazine (PubChem CID 69208451) has the molecular formula C26H26Cl2N6O2S and a molecular weight of 557.51 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-8-(4-chlorophenyl)-2-methyl-4-[(1S,4S)-5-propan-2-ylsulfonyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrazolo[1,5-a][1,3,5]triazine.
| Compound Name | 7-(2-chlorophenyl)-8-(4-chlorophenyl)-2-methyl-4-[(1S,4S)-5-propan-2-ylsulfonyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrazolo[1,5-a][1,3,5]triazine |
|---|---|
| PubChem CID | 69208451 |
| Molecular Formula | C26H26Cl2N6O2S |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 7-(2-chlorophenyl)-8-(4-chlorophenyl)-2-methyl-4-[(1S,4S)-5-propan-2-ylsulfonyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrazolo[1,5-a][1,3,5]triazine |
| SMILES | Cc1nc(N2C[C@@H]3C[C@H]2CN3S(=O)(=O)C(C)C)n2nc(-c3ccccc3Cl)c(-c3ccc(Cl)cc3)c2n1 |
| InChI | InChI=1S/C26H26Cl2N6O2S/c1-15(2)37(35,36)33-14-19-12-20(33)13-32(19)26-30-16(3)29-25-23(17-8-10-18(27)11-9-17)24(31-34(25)26)21-6-4-5-7-22(21)28/h4-11,15,19-20H,12-14H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | HYWLAHNFSRYSCO-PMACEKPBSA-N |
| XLogP | 5.07 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |