C28H31F2N3O3 — CID 69208684
(2S)-2-[[(2S,6S)-1-cyclopentyl-7-oxo-2-phenyl-5,6-dihydro-2H-azepin-6-yl]-[2-(3,5-difluorophenyl)acetyl]amino]propanamide (PubChem CID 69208684) has the molecular formula C28H31F2N3O3 and a molecular weight of 495.57 g/mol. Its IUPAC name is (2S)-2-[[(2S,6S)-1-cyclopentyl-7-oxo-2-phenyl-5,6-dihydro-2H-azepin-6-yl]-[2-(3,5-difluorophenyl)acetyl]amino]propanamide.
| Compound Name | (2S)-2-[[(2S,6S)-1-cyclopentyl-7-oxo-2-phenyl-5,6-dihydro-2H-azepin-6-yl]-[2-(3,5-difluorophenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 69208684 |
| Molecular Formula | C28H31F2N3O3 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (2S)-2-[[(2S,6S)-1-cyclopentyl-7-oxo-2-phenyl-5,6-dihydro-2H-azepin-6-yl]-[2-(3,5-difluorophenyl)acetyl]amino]propanamide |
| SMILES | C[C@@H](C(N)=O)N(C(=O)Cc1cc(F)cc(F)c1)[C@H]1CC=C[C@@H](c2ccccc2)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C28H31F2N3O3/c1-18(27(31)35)32(26(34)16-19-14-21(29)17-22(30)15-19)25-13-7-12-24(20-8-3-2-4-9-20)33(28(25)36)23-10-5-6-11-23/h2-4,7-9,12,14-15,17-18,23-25H,5-6,10-11,13,16H2,1H3,(H2,31,35)/t18-,24-,25-/m0/s1 |
| InChIKey | UABLOXBAAATOEY-WDNCENIBSA-N |
| XLogP | 4.05 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|