C36H44O6S — CID 69209576
1-O,1-O-ditert-butyl 3-O-ethyl 4-tritylsulfanylbutane-1,1,3-tricarboxylate (PubChem CID 69209576) has the molecular formula C36H44O6S and a molecular weight of 604.81 g/mol. Its IUPAC name is 1-O,1-O-ditert-butyl 3-O-ethyl 4-tritylsulfanylbutane-1,1,3-tricarboxylate.
| Compound Name | 1-O,1-O-ditert-butyl 3-O-ethyl 4-tritylsulfanylbutane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 69209576 |
| Molecular Formula | C36H44O6S |
| Molecular Weight | 604.81 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 1-O,1-O-ditert-butyl 3-O-ethyl 4-tritylsulfanylbutane-1,1,3-tricarboxylate |
| SMILES | CCOC(=O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H44O6S/c1-8-40-31(37)26(24-30(32(38)41-34(2,3)4)33(39)42-35(5,6)7)25-43-36(27-18-12-9-13-19-27,28-20-14-10-15-21-28)29-22-16-11-17-23-29/h9-23,26,30H,8,24-25H2,1-7H3 |
| InChIKey | GNKMPKJTAWDAIT-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.81 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|