About 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone
2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone (PubChem CID 69211790) has the molecular formula C19H17Cl2NO
and a molecular weight of 346.26 g/mol. Its IUPAC name is 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone.
Molecular Properties
| Compound Name | 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone |
| PubChem CID | 69211790 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone |
| SMILES | CC1(C)Cc2cc(Cl)ccc2C(=CC(=O)c2ccccc2Cl)N1 |
| InChI | InChI=1S/C19H17Cl2NO/c1-19(2)11-12-9-13(20)7-8-14(12)17(22-19)10-18(23)15-5-3-4-6-16(15)21/h3-10,22H,11H2,1-2H3 |
| InChIKey | NAYSBBZBUITETD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone?
The IUPAC name of 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone (CID 69211790) is 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone.
What is the SMILES notation for 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone?
The canonical SMILES for 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone is CC1(C)Cc2cc(Cl)ccc2C(=CC(=O)c2ccccc2Cl)N1.
What is the InChIKey of 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone?
The InChIKey is NAYSBBZBUITETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2NO/c1-19(2)11-12-9-13(20)7-8-14(12)17(22-19)10-18(23)15-5-3-4-6-16(15)21/h3-10,22H,11H2,1-2H3.
What are the key properties of 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone?
2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone has a molecular weight of 346.26 g/mol, XLogP of 5.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-(2-chlorophenyl)ethanone is sourced from PubChem (CID 69211790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).