C22H30Cl2F3N5O3S — CID 69213733
2-[2-[2-(2-methoxyethyl)-4-[5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaen-2-yl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride (PubChem CID 69213733) has the molecular formula C22H30Cl2F3N5O3S and a molecular weight of 572.48 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethyl)-4-[5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaen-2-yl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride.
| Compound Name | 2-[2-[2-(2-methoxyethyl)-4-[5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaen-2-yl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 69213733 |
| Molecular Formula | C22H30Cl2F3N5O3S |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 2-[2-[2-(2-methoxyethyl)-4-[5-(trifluoromethyl)-6-thia-4,8,14-triazatricyclo[8.4.0.03,7]tetradeca-1,3(7),4,9,11,13-hexaen-2-yl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride |
| SMILES | COCCC1CN(C2=c3ncccc3=CNc3sc(C(F)(F)F)nc32)CCN1CCOCCO.Cl.Cl |
| InChI | InChI=1S/C22H28F3N5O3S.2ClH/c1-32-10-4-16-14-30(7-6-29(16)8-11-33-12-9-31)19-17-15(3-2-5-26-17)13-27-20-18(19)28-21(34-20)22(23,24)25;;/h2-3,5,13,16,27,31H,4,6-12,14H2,1H3;2*1H |
| InChIKey | FZANUFVRMMZTHP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|